C11H11N3O6S — CID 82913263
2-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]-5-sulfamoylbenzoic acid (PubChem CID 82913263) has the molecular formula C11H11N3O6S and a molecular weight of 313.29 g/mol. Its IUPAC name is 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]-5-sulfamoylbenzoic acid.
| Compound Name | 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 82913263 |
| Molecular Formula | C11H11N3O6S |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]-5-sulfamoylbenzoic acid |
| SMILES | Cc1nc(COc2ccc(S(N)(=O)=O)cc2C(=O)O)no1 |
| InChI | InChI=1S/C11H11N3O6S/c1-6-13-10(14-20-6)5-19-9-3-2-7(21(12,17)18)4-8(9)11(15)16/h2-4H,5H2,1H3,(H,15,16)(H2,12,17,18) |
| InChIKey | WKRVAOKRXDRJOA-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 145.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |