C10H9F4NOS — CID 66277832
3-fluoro-4-(1,1,1-trifluoropropan-2-yloxy)benzenecarbothioamide (PubChem CID 66277832) has the molecular formula C10H9F4NOS and a molecular weight of 267.25 g/mol. Its IUPAC name is 3-fluoro-4-(1,1,1-trifluoropropan-2-yloxy)benzenecarbothioamide.
| Compound Name | 3-fluoro-4-(1,1,1-trifluoropropan-2-yloxy)benzenecarbothioamide |
|---|---|
| PubChem CID | 66277832 |
| Molecular Formula | C10H9F4NOS |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 3-fluoro-4-(1,1,1-trifluoropropan-2-yloxy)benzenecarbothioamide |
| SMILES | CC(Oc1ccc(C(N)=S)cc1F)C(F)(F)F |
| InChI | InChI=1S/C10H9F4NOS/c1-5(10(12,13)14)16-8-3-2-6(9(15)17)4-7(8)11/h2-5H,1H3,(H2,15,17) |
| InChIKey | IXUQZKKJRGUDNS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|