C10H11F3N2O2 — CID 66276054
4-amino-3-(1,1,1-trifluoropropan-2-yloxy)benzamide (PubChem CID 66276054) has the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. Its IUPAC name is 4-amino-3-(1,1,1-trifluoropropan-2-yloxy)benzamide.
| Compound Name | 4-amino-3-(1,1,1-trifluoropropan-2-yloxy)benzamide |
|---|---|
| PubChem CID | 66276054 |
| Molecular Formula | C10H11F3N2O2 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 4-amino-3-(1,1,1-trifluoropropan-2-yloxy)benzamide |
| SMILES | CC(Oc1cc(C(N)=O)ccc1N)C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O2/c1-5(10(11,12)13)17-8-4-6(9(15)16)2-3-7(8)14/h2-5H,14H2,1H3,(H2,15,16) |
| InChIKey | RWYLKCLTDLQIHF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|