C11H13F3N2O2 — CID 66276494
4-amino-N-methyl-3-(1,1,1-trifluoropropan-2-yloxy)benzamide (PubChem CID 66276494) has the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. Its IUPAC name is 4-amino-N-methyl-3-(1,1,1-trifluoropropan-2-yloxy)benzamide.
| Compound Name | 4-amino-N-methyl-3-(1,1,1-trifluoropropan-2-yloxy)benzamide |
|---|---|
| PubChem CID | 66276494 |
| Molecular Formula | C11H13F3N2O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 4-amino-N-methyl-3-(1,1,1-trifluoropropan-2-yloxy)benzamide |
| SMILES | CNC(=O)c1ccc(N)c(OC(C)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F3N2O2/c1-6(11(12,13)14)18-9-5-7(10(17)16-2)3-4-8(9)15/h3-6H,15H2,1-2H3,(H,16,17) |
| InChIKey | AUTRIQMRSJXVOR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|