C13H10F2N2O2 — CID 55189641
4-amino-3-(3,5-difluorophenoxy)benzamide (PubChem CID 55189641) has the molecular formula C13H10F2N2O2 and a molecular weight of 264.23 g/mol. Its IUPAC name is 4-amino-3-(3,5-difluorophenoxy)benzamide.
| Compound Name | 4-amino-3-(3,5-difluorophenoxy)benzamide |
|---|---|
| PubChem CID | 55189641 |
| Molecular Formula | C13H10F2N2O2 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 4-amino-3-(3,5-difluorophenoxy)benzamide |
| SMILES | NC(=O)c1ccc(N)c(Oc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C13H10F2N2O2/c14-8-4-9(15)6-10(5-8)19-12-3-7(13(17)18)1-2-11(12)16/h1-6H,16H2,(H2,17,18) |
| InChIKey | QTKQWRDIANICNT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|