C15H12BrF2I — CID 114029530
2-[bromo-(4-fluoro-2-iodophenyl)methyl]-5-fluoro-1,3-dimethylbenzene (PubChem CID 114029530) has the molecular formula C15H12BrF2I and a molecular weight of 437.07 g/mol. Its IUPAC name is 2-[bromo-(4-fluoro-2-iodophenyl)methyl]-5-fluoro-1,3-dimethylbenzene.
| Compound Name | 2-[bromo-(4-fluoro-2-iodophenyl)methyl]-5-fluoro-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 114029530 |
| Molecular Formula | C15H12BrF2I |
| Molecular Weight | 437.07 g/mol |
| Exact Mass | 435.91 |
| IUPAC Name | 2-[bromo-(4-fluoro-2-iodophenyl)methyl]-5-fluoro-1,3-dimethylbenzene |
| SMILES | Cc1cc(F)cc(C)c1C(Br)c1ccc(F)cc1I |
| InChI | InChI=1S/C15H12BrF2I/c1-8-5-11(18)6-9(2)14(8)15(16)12-4-3-10(17)7-13(12)19/h3-7,15H,1-2H3 |
| InChIKey | PCSQLIOCJZZDIJ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.07 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|