C11H12Cl2S — CID 144669158
3,6-dichloro-2-methyl-1-benzothiophene;ethane (PubChem CID 144669158) has the molecular formula C11H12Cl2S and a molecular weight of 247.19 g/mol. Its IUPAC name is 3,6-dichloro-2-methyl-1-benzothiophene;ethane.
| Compound Name | 3,6-dichloro-2-methyl-1-benzothiophene;ethane |
|---|---|
| PubChem CID | 144669158 |
| Molecular Formula | C11H12Cl2S |
| Molecular Weight | 247.19 g/mol |
| Exact Mass | 246.00 |
| IUPAC Name | 3,6-dichloro-2-methyl-1-benzothiophene;ethane |
| SMILES | CC.Cc1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C9H6Cl2S.C2H6/c1-5-9(11)7-3-2-6(10)4-8(7)12-5;1-2/h2-4H,1H3;1-2H3 |
| InChIKey | WVVSSIGTLLCLFY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.19 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |