C9H7Cl2NS — CID 82363899
(3,6-dichloro-1-benzothiophen-2-yl)methanamine (PubChem CID 82363899) has the molecular formula C9H7Cl2NS and a molecular weight of 232.14 g/mol. Its IUPAC name is (3,6-dichloro-1-benzothiophen-2-yl)methanamine.
| Compound Name | (3,6-dichloro-1-benzothiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 82363899 |
| Molecular Formula | C9H7Cl2NS |
| Molecular Weight | 232.14 g/mol |
| Exact Mass | 230.97 |
| IUPAC Name | (3,6-dichloro-1-benzothiophen-2-yl)methanamine |
| SMILES | NCc1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C9H7Cl2NS/c10-5-1-2-6-7(3-5)13-8(4-12)9(6)11/h1-3H,4,12H2 |
| InChIKey | QUVXLJKZVSRMSL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.14 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |