C7H3Cl2NS — CID 10560097
3,6-dichloro-1,2-benzothiazole (PubChem CID 10560097) has the molecular formula C7H3Cl2NS and a molecular weight of 204.08 g/mol. Its IUPAC name is 3,6-dichloro-1,2-benzothiazole.
| Compound Name | 3,6-dichloro-1,2-benzothiazole |
|---|---|
| PubChem CID | 10560097 |
| Molecular Formula | C7H3Cl2NS |
| Molecular Weight | 204.08 g/mol |
| Exact Mass | 202.94 |
| IUPAC Name | 3,6-dichloro-1,2-benzothiazole |
| SMILES | Clc1ccc2c(Cl)nsc2c1 |
| InChI | InChI=1S/C7H3Cl2NS/c8-4-1-2-5-6(3-4)11-10-7(5)9/h1-3H |
| InChIKey | NEYRYYMMDZQOFG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.08 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |