About 3,6-dichloro-1,2-benzothiazole
3,6-dichloro-1,2-benzothiazole (PubChem CID 10560097) has the molecular formula C7H3Cl2NS
and a molecular weight of 204.08 g/mol. Its IUPAC name is 3,6-dichloro-1,2-benzothiazole.
Molecular Properties
| Compound Name | 3,6-dichloro-1,2-benzothiazole |
| PubChem CID | 10560097 |
| Molecular Formula | C7H3Cl2NS |
| Molecular Weight | 204.08 g/mol |
| Exact Mass | 202.94 |
| IUPAC Name | 3,6-dichloro-1,2-benzothiazole |
| SMILES | Clc1ccc2c(Cl)nsc2c1 |
| InChI | InChI=1S/C7H3Cl2NS/c8-4-1-2-5-6(3-4)11-10-7(5)9/h1-3H |
| InChIKey | NEYRYYMMDZQOFG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.08 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,6-dichloro-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dichloro-1,2-benzothiazole?
The IUPAC name of 3,6-dichloro-1,2-benzothiazole (CID 10560097) is 3,6-dichloro-1,2-benzothiazole.
What is the SMILES notation for 3,6-dichloro-1,2-benzothiazole?
The canonical SMILES for 3,6-dichloro-1,2-benzothiazole is Clc1ccc2c(Cl)nsc2c1.
What is the InChIKey of 3,6-dichloro-1,2-benzothiazole?
The InChIKey is NEYRYYMMDZQOFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Cl2NS/c8-4-1-2-5-6(3-4)11-10-7(5)9/h1-3H.
What are the key properties of 3,6-dichloro-1,2-benzothiazole?
3,6-dichloro-1,2-benzothiazole has a molecular weight of 204.08 g/mol, XLogP of 3.60, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dichloro-1,2-benzothiazole is sourced from PubChem (CID 10560097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).