C10H6ClNS — CID 155424825
6-chloro-3-prop-1-ynyl-1,2-benzothiazole (PubChem CID 155424825) has the molecular formula C10H6ClNS and a molecular weight of 207.69 g/mol. Its IUPAC name is 6-chloro-3-prop-1-ynyl-1,2-benzothiazole.
| Compound Name | 6-chloro-3-prop-1-ynyl-1,2-benzothiazole |
|---|---|
| PubChem CID | 155424825 |
| Molecular Formula | C10H6ClNS |
| Molecular Weight | 207.69 g/mol |
| Exact Mass | 206.99 |
| IUPAC Name | 6-chloro-3-prop-1-ynyl-1,2-benzothiazole |
| SMILES | CC#Cc1nsc2cc(Cl)ccc12 |
| InChI | InChI=1S/C10H6ClNS/c1-2-3-9-8-5-4-7(11)6-10(8)13-12-9/h4-6H,1H3 |
| InChIKey | SGBDAXFEVIGNSG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.69 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|