C9H8ClN3OS — CID 119089088
N-(6-chloro-1,2-benzothiazol-3-yl)-N-ethylnitrous amide (PubChem CID 119089088) has the molecular formula C9H8ClN3OS and a molecular weight of 241.70 g/mol. Its IUPAC name is N-(6-chloro-1,2-benzothiazol-3-yl)-N-ethylnitrous amide.
| Compound Name | N-(6-chloro-1,2-benzothiazol-3-yl)-N-ethylnitrous amide |
|---|---|
| PubChem CID | 119089088 |
| Molecular Formula | C9H8ClN3OS |
| Molecular Weight | 241.70 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | N-(6-chloro-1,2-benzothiazol-3-yl)-N-ethylnitrous amide |
| SMILES | CCN(N=O)c1nsc2cc(Cl)ccc12 |
| InChI | InChI=1S/C9H8ClN3OS/c1-2-13(12-14)9-7-4-3-6(10)5-8(7)15-11-9/h3-5H,2H2,1H3 |
| InChIKey | MNXARFCWKZKTOZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.70 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|