C16H13ClN2OS — CID 59141837
N-(4-chloro-1,2-benzothiazol-3-yl)-N-ethylbenzamide (PubChem CID 59141837) has the molecular formula C16H13ClN2OS and a molecular weight of 316.81 g/mol. Its IUPAC name is N-(4-chloro-1,2-benzothiazol-3-yl)-N-ethylbenzamide.
| Compound Name | N-(4-chloro-1,2-benzothiazol-3-yl)-N-ethylbenzamide |
|---|---|
| PubChem CID | 59141837 |
| Molecular Formula | C16H13ClN2OS |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | N-(4-chloro-1,2-benzothiazol-3-yl)-N-ethylbenzamide |
| SMILES | CCN(C(=O)c1ccccc1)c1nsc2cccc(Cl)c12 |
| InChI | InChI=1S/C16H13ClN2OS/c1-2-19(16(20)11-7-4-3-5-8-11)15-14-12(17)9-6-10-13(14)21-18-15/h3-10H,2H2,1H3 |
| InChIKey | MKSZXXPTKONNBR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |