C14H9Cl2N3OS — CID 59141892
6-chloro-N-(4-chloro-1,2-benzothiazol-3-yl)-N-methylpyridine-3-carboxamide (PubChem CID 59141892) has the molecular formula C14H9Cl2N3OS and a molecular weight of 338.22 g/mol. Its IUPAC name is 6-chloro-N-(4-chloro-1,2-benzothiazol-3-yl)-N-methylpyridine-3-carboxamide.
| Compound Name | 6-chloro-N-(4-chloro-1,2-benzothiazol-3-yl)-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 59141892 |
| Molecular Formula | C14H9Cl2N3OS |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | 6-chloro-N-(4-chloro-1,2-benzothiazol-3-yl)-N-methylpyridine-3-carboxamide |
| SMILES | CN(C(=O)c1ccc(Cl)nc1)c1nsc2cccc(Cl)c12 |
| InChI | InChI=1S/C14H9Cl2N3OS/c1-19(14(20)8-5-6-11(16)17-7-8)13-12-9(15)3-2-4-10(12)21-18-13/h2-7H,1H3 |
| InChIKey | CMUZZYYXKWKFTJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|