C13H8ClNOS — CID 135847954
3-(4-chlorophenyl)-1,2-benzothiazol-6-ol (PubChem CID 135847954) has the molecular formula C13H8ClNOS and a molecular weight of 261.73 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1,2-benzothiazol-6-ol.
| Compound Name | 3-(4-chlorophenyl)-1,2-benzothiazol-6-ol |
|---|---|
| PubChem CID | 135847954 |
| Molecular Formula | C13H8ClNOS |
| Molecular Weight | 261.73 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 3-(4-chlorophenyl)-1,2-benzothiazol-6-ol |
| SMILES | Oc1ccc2c(-c3ccc(Cl)cc3)nsc2c1 |
| InChI | InChI=1S/C13H8ClNOS/c14-9-3-1-8(2-4-9)13-11-6-5-10(16)7-12(11)17-15-13/h1-7,16H |
| InChIKey | OSOAOPAFNRMTCW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.73 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |