C14H7ClF3NO3S2 — CID 86585419
[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl] trifluoromethanesulfonate (PubChem CID 86585419) has the molecular formula C14H7ClF3NO3S2 and a molecular weight of 393.80 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-1,2-benzothiazol-6-yl] trifluoromethanesulfonate.
| Compound Name | [3-(4-chlorophenyl)-1,2-benzothiazol-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86585419 |
| Molecular Formula | C14H7ClF3NO3S2 |
| Molecular Weight | 393.80 g/mol |
| Exact Mass | 392.95 |
| IUPAC Name | [3-(4-chlorophenyl)-1,2-benzothiazol-6-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c(-c3ccc(Cl)cc3)nsc2c1)C(F)(F)F |
| InChI | InChI=1S/C14H7ClF3NO3S2/c15-9-3-1-8(2-4-9)13-11-6-5-10(7-12(11)23-19-13)22-24(20,21)14(16,17)18/h1-7H |
| InChIKey | FEOPBEVCAKPUTA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.80 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|