C14H8F3NOS — CID 135847955
3-[4-(trifluoromethyl)phenyl]-1,2-benzothiazol-6-ol (PubChem CID 135847955) has the molecular formula C14H8F3NOS and a molecular weight of 295.29 g/mol. Its IUPAC name is 3-[4-(trifluoromethyl)phenyl]-1,2-benzothiazol-6-ol.
| Compound Name | 3-[4-(trifluoromethyl)phenyl]-1,2-benzothiazol-6-ol |
|---|---|
| PubChem CID | 135847955 |
| Molecular Formula | C14H8F3NOS |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 3-[4-(trifluoromethyl)phenyl]-1,2-benzothiazol-6-ol |
| SMILES | Oc1ccc2c(-c3ccc(C(F)(F)F)cc3)nsc2c1 |
| InChI | InChI=1S/C14H8F3NOS/c15-14(16,17)9-3-1-8(2-4-9)13-11-6-5-10(19)7-12(11)20-18-13/h1-7,19H |
| InChIKey | FIYGBTMHPVSKNN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |