C17H10F3NOS — CID 175212407
3-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2-thiazole-4-carbaldehyde (PubChem CID 175212407) has the molecular formula C17H10F3NOS and a molecular weight of 333.33 g/mol. Its IUPAC name is 3-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2-thiazole-4-carbaldehyde.
| Compound Name | 3-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 175212407 |
| Molecular Formula | C17H10F3NOS |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 3-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2-thiazole-4-carbaldehyde |
| SMILES | O=Cc1c(-c2ccccc2)nsc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H10F3NOS/c18-17(19,20)13-8-6-12(7-9-13)16-14(10-22)15(21-23-16)11-4-2-1-3-5-11/h1-10H |
| InChIKey | IYCSFEXXQGSFNV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|