C37H23F6N — CID 102130644
2,3,6-triphenyl-4,5-bis[4-(trifluoromethyl)phenyl]pyridine (PubChem CID 102130644) has the molecular formula C37H23F6N and a molecular weight of 595.59 g/mol. Its IUPAC name is 2,3,6-triphenyl-4,5-bis[4-(trifluoromethyl)phenyl]pyridine.
| Compound Name | 2,3,6-triphenyl-4,5-bis[4-(trifluoromethyl)phenyl]pyridine |
|---|---|
| PubChem CID | 102130644 |
| Molecular Formula | C37H23F6N |
| Molecular Weight | 595.59 g/mol |
| Exact Mass | 595.17 |
| IUPAC Name | 2,3,6-triphenyl-4,5-bis[4-(trifluoromethyl)phenyl]pyridine |
| SMILES | FC(F)(F)c1ccc(-c2c(-c3ccccc3)nc(-c3ccccc3)c(-c3ccccc3)c2-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C37H23F6N/c38-36(39,40)29-20-16-25(17-21-29)31-32(24-10-4-1-5-11-24)34(27-12-6-2-7-13-27)44-35(28-14-8-3-9-15-28)33(31)26-18-22-30(23-19-26)37(41,42)43/h1-23H |
| InChIKey | BHGUXANQOVSJCX-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.59 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |