C22H14F4N2 — CID 102333222
4-(4-fluorophenyl)-2-phenyl-5-[4-(trifluoromethyl)phenyl]-1H-imidazole (PubChem CID 102333222) has the molecular formula C22H14F4N2 and a molecular weight of 382.36 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2-phenyl-5-[4-(trifluoromethyl)phenyl]-1H-imidazole.
| Compound Name | 4-(4-fluorophenyl)-2-phenyl-5-[4-(trifluoromethyl)phenyl]-1H-imidazole |
|---|---|
| PubChem CID | 102333222 |
| Molecular Formula | C22H14F4N2 |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 4-(4-fluorophenyl)-2-phenyl-5-[4-(trifluoromethyl)phenyl]-1H-imidazole |
| SMILES | Fc1ccc(-c2nc(-c3ccccc3)[nH]c2-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H14F4N2/c23-18-12-8-15(9-13-18)20-19(14-6-10-17(11-7-14)22(24,25)26)27-21(28-20)16-4-2-1-3-5-16/h1-13H,(H,27,28) |
| InChIKey | QEIIMVIUBKZGEU-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|