C23H16F4N2O2S — CID 142636183
5-(4-fluorophenyl)-4-(4-methylsulfonylphenyl)-2-[3-(trifluoromethyl)phenyl]-1H-imidazole (PubChem CID 142636183) has the molecular formula C23H16F4N2O2S and a molecular weight of 460.45 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-4-(4-methylsulfonylphenyl)-2-[3-(trifluoromethyl)phenyl]-1H-imidazole.
| Compound Name | 5-(4-fluorophenyl)-4-(4-methylsulfonylphenyl)-2-[3-(trifluoromethyl)phenyl]-1H-imidazole |
|---|---|
| PubChem CID | 142636183 |
| Molecular Formula | C23H16F4N2O2S |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 5-(4-fluorophenyl)-4-(4-methylsulfonylphenyl)-2-[3-(trifluoromethyl)phenyl]-1H-imidazole |
| SMILES | CS(=O)(=O)c1ccc(-c2nc(-c3cccc(C(F)(F)F)c3)[nH]c2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H16F4N2O2S/c1-32(30,31)19-11-7-15(8-12-19)21-20(14-5-9-18(24)10-6-14)28-22(29-21)16-3-2-4-17(13-16)23(25,26)27/h2-13H,1H3,(H,28,29) |
| InChIKey | TVPLSKVWSRUCFV-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|