C24H22ClF3O6S — CID 87279263
2-[1-(4-chlorophenyl)-3-methyl-6-(trifluoromethylsulfonyloxy)naphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid (PubChem CID 87279263) has the molecular formula C24H22ClF3O6S and a molecular weight of 530.95 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)-3-methyl-6-(trifluoromethylsulfonyloxy)naphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid.
| Compound Name | 2-[1-(4-chlorophenyl)-3-methyl-6-(trifluoromethylsulfonyloxy)naphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 87279263 |
| Molecular Formula | C24H22ClF3O6S |
| Molecular Weight | 530.95 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | 2-[1-(4-chlorophenyl)-3-methyl-6-(trifluoromethylsulfonyloxy)naphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
| SMILES | Cc1cc2cc(OS(=O)(=O)C(F)(F)F)ccc2c(-c2ccc(Cl)cc2)c1C(OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C24H22ClF3O6S/c1-13-11-15-12-17(34-35(31,32)24(26,27)28)9-10-18(15)20(14-5-7-16(25)8-6-14)19(13)21(22(29)30)33-23(2,3)4/h5-12,21H,1-4H3,(H,29,30) |
| InChIKey | UUMXKQSNVMCVPR-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.95 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|