C21H22F4O6S — CID 87279320
2-[7-fluoro-3-methyl-6-prop-1-en-2-yl-1-(trifluoromethylsulfonyloxy)naphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid (PubChem CID 87279320) has the molecular formula C21H22F4O6S and a molecular weight of 478.46 g/mol. Its IUPAC name is 2-[7-fluoro-3-methyl-6-prop-1-en-2-yl-1-(trifluoromethylsulfonyloxy)naphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid.
| Compound Name | 2-[7-fluoro-3-methyl-6-prop-1-en-2-yl-1-(trifluoromethylsulfonyloxy)naphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 87279320 |
| Molecular Formula | C21H22F4O6S |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 2-[7-fluoro-3-methyl-6-prop-1-en-2-yl-1-(trifluoromethylsulfonyloxy)naphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
| SMILES | C=C(C)c1cc2cc(C)c(C(OC(C)(C)C)C(=O)O)c(OS(=O)(=O)C(F)(F)F)c2cc1F |
| InChI | InChI=1S/C21H22F4O6S/c1-10(2)13-8-12-7-11(3)16(18(19(26)27)30-20(4,5)6)17(14(12)9-15(13)22)31-32(28,29)21(23,24)25/h7-9,18H,1H2,2-6H3,(H,26,27) |
| InChIKey | WPUPMZGTZOAPQT-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|