C22H18BrF3O7S — CID 151745668
2-[5-bromo-3-methyl-1-(trifluoromethylsulfonyloxy)naphthalen-2-yl]-2-[(4-methoxyphenyl)methoxy]acetic acid (PubChem CID 151745668) has the molecular formula C22H18BrF3O7S and a molecular weight of 563.34 g/mol. Its IUPAC name is 2-[5-bromo-3-methyl-1-(trifluoromethylsulfonyloxy)naphthalen-2-yl]-2-[(4-methoxyphenyl)methoxy]acetic acid.
| Compound Name | 2-[5-bromo-3-methyl-1-(trifluoromethylsulfonyloxy)naphthalen-2-yl]-2-[(4-methoxyphenyl)methoxy]acetic acid |
|---|---|
| PubChem CID | 151745668 |
| Molecular Formula | C22H18BrF3O7S |
| Molecular Weight | 563.34 g/mol |
| Exact Mass | 561.99 |
| IUPAC Name | 2-[5-bromo-3-methyl-1-(trifluoromethylsulfonyloxy)naphthalen-2-yl]-2-[(4-methoxyphenyl)methoxy]acetic acid |
| SMILES | COc1ccc(COC(C(=O)O)c2c(C)cc3c(Br)cccc3c2OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H18BrF3O7S/c1-12-10-16-15(4-3-5-17(16)23)19(33-34(29,30)22(24,25)26)18(12)20(21(27)28)32-11-13-6-8-14(31-2)9-7-13/h3-10,20H,11H2,1-2H3,(H,27,28) |
| InChIKey | RNLSOTNJFULPIT-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.34 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|