C18H19F3O5S — CID 118027233
ethyl 2-[3,6-dimethyl-1-(trifluoromethylsulfonyloxy)naphthalen-2-yl]propanoate (PubChem CID 118027233) has the molecular formula C18H19F3O5S and a molecular weight of 404.41 g/mol. Its IUPAC name is ethyl 2-[3,6-dimethyl-1-(trifluoromethylsulfonyloxy)naphthalen-2-yl]propanoate.
| Compound Name | ethyl 2-[3,6-dimethyl-1-(trifluoromethylsulfonyloxy)naphthalen-2-yl]propanoate |
|---|---|
| PubChem CID | 118027233 |
| Molecular Formula | C18H19F3O5S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | ethyl 2-[3,6-dimethyl-1-(trifluoromethylsulfonyloxy)naphthalen-2-yl]propanoate |
| SMILES | CCOC(=O)C(C)c1c(C)cc2cc(C)ccc2c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C18H19F3O5S/c1-5-25-17(22)12(4)15-11(3)9-13-8-10(2)6-7-14(13)16(15)26-27(23,24)18(19,20)21/h6-9,12H,5H2,1-4H3 |
| InChIKey | OKROULFTAJNJJI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|