C20H22F4O6S — CID 86691560
ethyl 2-[4-fluoro-3-methyl-1-(trifluoromethylsulfonyloxy)naphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]acetate (PubChem CID 86691560) has the molecular formula C20H22F4O6S and a molecular weight of 466.45 g/mol. Its IUPAC name is ethyl 2-[4-fluoro-3-methyl-1-(trifluoromethylsulfonyloxy)naphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]acetate.
| Compound Name | ethyl 2-[4-fluoro-3-methyl-1-(trifluoromethylsulfonyloxy)naphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]acetate |
|---|---|
| PubChem CID | 86691560 |
| Molecular Formula | C20H22F4O6S |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | ethyl 2-[4-fluoro-3-methyl-1-(trifluoromethylsulfonyloxy)naphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]acetate |
| SMILES | CCOC(=O)C(OC(C)(C)C)c1c(C)c(F)c2ccccc2c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C20H22F4O6S/c1-6-28-18(25)17(29-19(3,4)5)14-11(2)15(21)12-9-7-8-10-13(12)16(14)30-31(26,27)20(22,23)24/h7-10,17H,6H2,1-5H3 |
| InChIKey | INYGZXRGUWJQFK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|