C33H34F3NO7S2 — CID 118310957
2-[5-methyl-2-[3-[5-methyl-2-[(2S)-pent-4-en-2-yl]oxyphenyl]phenyl]-7-(trifluoromethylsulfonyloxy)-1,3-benzothiazol-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid (PubChem CID 118310957) has the molecular formula C33H34F3NO7S2 and a molecular weight of 677.76 g/mol. Its IUPAC name is 2-[5-methyl-2-[3-[5-methyl-2-[(2S)-pent-4-en-2-yl]oxyphenyl]phenyl]-7-(trifluoromethylsulfonyloxy)-1,3-benzothiazol-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid.
| Compound Name | 2-[5-methyl-2-[3-[5-methyl-2-[(2S)-pent-4-en-2-yl]oxyphenyl]phenyl]-7-(trifluoromethylsulfonyloxy)-1,3-benzothiazol-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 118310957 |
| Molecular Formula | C33H34F3NO7S2 |
| Molecular Weight | 677.76 g/mol |
| Exact Mass | 677.17 |
| IUPAC Name | 2-[5-methyl-2-[3-[5-methyl-2-[(2S)-pent-4-en-2-yl]oxyphenyl]phenyl]-7-(trifluoromethylsulfonyloxy)-1,3-benzothiazol-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
| SMILES | C=CC[C@H](C)Oc1ccc(C)cc1-c1cccc(-c2nc3cc(C)c(C(OC(C)(C)C)C(=O)O)c(OS(=O)(=O)C(F)(F)F)c3s2)c1 |
| InChI | InChI=1S/C33H34F3NO7S2/c1-8-10-20(4)42-25-14-13-18(2)15-23(25)21-11-9-12-22(17-21)30-37-24-16-19(3)26(28(31(38)39)43-32(5,6)7)27(29(24)45-30)44-46(40,41)33(34,35)36/h8-9,11-17,20,28H,1,10H2,2-7H3,(H,38,39)/t20-,28?/m0/s1 |
| InChIKey | JGIWKKNFBVGPAI-CQHAJPFMSA-N |
| XLogP | 8.76 |
| TPSA | 112.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.76 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|