C23H22ClNO4 — CID 87083554
2-[5-(4-chlorophenyl)-2-formyl-7-methylquinolin-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid (PubChem CID 87083554) has the molecular formula C23H22ClNO4 and a molecular weight of 411.89 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-2-formyl-7-methylquinolin-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid.
| Compound Name | 2-[5-(4-chlorophenyl)-2-formyl-7-methylquinolin-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 87083554 |
| Molecular Formula | C23H22ClNO4 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-2-formyl-7-methylquinolin-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
| SMILES | Cc1cc2nc(C=O)ccc2c(-c2ccc(Cl)cc2)c1C(OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C23H22ClNO4/c1-13-11-18-17(10-9-16(12-26)25-18)20(14-5-7-15(24)8-6-14)19(13)21(22(27)28)29-23(2,3)4/h5-12,21H,1-4H3,(H,27,28) |
| InChIKey | VEDZNQWVYHAJAM-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|