C16H15NO2S — CID 13270208
5,6-dimethoxy-3-(4-methylphenyl)-1,2-benzothiazole (PubChem CID 13270208) has the molecular formula C16H15NO2S and a molecular weight of 285.37 g/mol. Its IUPAC name is 5,6-dimethoxy-3-(4-methylphenyl)-1,2-benzothiazole.
| Compound Name | 5,6-dimethoxy-3-(4-methylphenyl)-1,2-benzothiazole |
|---|---|
| PubChem CID | 13270208 |
| Molecular Formula | C16H15NO2S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 5,6-dimethoxy-3-(4-methylphenyl)-1,2-benzothiazole |
| SMILES | COc1cc2snc(-c3ccc(C)cc3)c2cc1OC |
| InChI | InChI=1S/C16H15NO2S/c1-10-4-6-11(7-5-10)16-12-8-13(18-2)14(19-3)9-15(12)20-17-16/h4-9H,1-3H3 |
| InChIKey | CVGPJIJQMMUSLU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |