C11H15NS — CID 142044862
3,5-dimethyl-1,2-benzothiazole;ethane (PubChem CID 142044862) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is 3,5-dimethyl-1,2-benzothiazole;ethane.
| Compound Name | 3,5-dimethyl-1,2-benzothiazole;ethane |
|---|---|
| PubChem CID | 142044862 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 3,5-dimethyl-1,2-benzothiazole;ethane |
| SMILES | CC.Cc1ccc2snc(C)c2c1 |
| InChI | InChI=1S/C9H9NS.C2H6/c1-6-3-4-9-8(5-6)7(2)10-11-9;1-2/h3-5H,1-2H3;1-2H3 |
| InChIKey | NLTPUACWNVFWAB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |