C12H17NS — CID 90929193
ethane;6-ethyl-3-methyl-1,2-benzothiazole (PubChem CID 90929193) has the molecular formula C12H17NS and a molecular weight of 207.34 g/mol. Its IUPAC name is ethane;6-ethyl-3-methyl-1,2-benzothiazole.
| Compound Name | ethane;6-ethyl-3-methyl-1,2-benzothiazole |
|---|---|
| PubChem CID | 90929193 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | ethane;6-ethyl-3-methyl-1,2-benzothiazole |
| SMILES | CC.CCc1ccc2c(C)nsc2c1 |
| InChI | InChI=1S/C10H11NS.C2H6/c1-3-8-4-5-9-7(2)11-12-10(9)6-8;1-2/h4-6H,3H2,1-2H3;1-2H3 |
| InChIKey | NKXUOZDWSPXNPB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |