C12H17NS — CID 142320291
6-ethyl-1,2-benzothiazole;propane (PubChem CID 142320291) has the molecular formula C12H17NS and a molecular weight of 207.34 g/mol. Its IUPAC name is 6-ethyl-1,2-benzothiazole;propane.
| Compound Name | 6-ethyl-1,2-benzothiazole;propane |
|---|---|
| PubChem CID | 142320291 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 6-ethyl-1,2-benzothiazole;propane |
| SMILES | CCC.CCc1ccc2cnsc2c1 |
| InChI | InChI=1S/C9H9NS.C3H8/c1-2-7-3-4-8-6-10-11-9(8)5-7;1-3-2/h3-6H,2H2,1H3;3H2,1-2H3 |
| InChIKey | FSQBLVVRAQAIMW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |