C18H16N2S4 — CID 18330964
6-ethyl-2-[(6-ethyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole (PubChem CID 18330964) has the molecular formula C18H16N2S4 and a molecular weight of 388.61 g/mol. Its IUPAC name is 6-ethyl-2-[(6-ethyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole.
| Compound Name | 6-ethyl-2-[(6-ethyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 18330964 |
| Molecular Formula | C18H16N2S4 |
| Molecular Weight | 388.61 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | 6-ethyl-2-[(6-ethyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole |
| SMILES | CCc1ccc2nc(SSc3nc4ccc(CC)cc4s3)sc2c1 |
| InChI | InChI=1S/C18H16N2S4/c1-3-11-5-7-13-15(9-11)21-17(19-13)23-24-18-20-14-8-6-12(4-2)10-16(14)22-18/h5-10H,3-4H2,1-2H3 |
| InChIKey | PPHSKOYZHWKEDS-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.61 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|