C15H16N4S — CID 108778357
N-(4,6-dimethylpyrimidin-2-yl)-6-ethyl-1,3-benzothiazol-2-amine (PubChem CID 108778357) has the molecular formula C15H16N4S and a molecular weight of 284.39 g/mol. Its IUPAC name is N-(4,6-dimethylpyrimidin-2-yl)-6-ethyl-1,3-benzothiazol-2-amine.
| Compound Name | N-(4,6-dimethylpyrimidin-2-yl)-6-ethyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 108778357 |
| Molecular Formula | C15H16N4S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | N-(4,6-dimethylpyrimidin-2-yl)-6-ethyl-1,3-benzothiazol-2-amine |
| SMILES | CCc1ccc2nc(Nc3nc(C)cc(C)n3)sc2c1 |
| InChI | InChI=1S/C15H16N4S/c1-4-11-5-6-12-13(8-11)20-15(18-12)19-14-16-9(2)7-10(3)17-14/h5-8H,4H2,1-3H3,(H,16,17,18,19) |
| InChIKey | BBXSMEAXIUCJPF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |