C15H23NS — CID 142320574
2-tert-butyl-6-ethyl-1,3-benzothiazole;ethane (PubChem CID 142320574) has the molecular formula C15H23NS and a molecular weight of 249.42 g/mol. Its IUPAC name is 2-tert-butyl-6-ethyl-1,3-benzothiazole;ethane.
| Compound Name | 2-tert-butyl-6-ethyl-1,3-benzothiazole;ethane |
|---|---|
| PubChem CID | 142320574 |
| Molecular Formula | C15H23NS |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 2-tert-butyl-6-ethyl-1,3-benzothiazole;ethane |
| SMILES | CC.CCc1ccc2nc(C(C)(C)C)sc2c1 |
| InChI | InChI=1S/C13H17NS.C2H6/c1-5-9-6-7-10-11(8-9)15-12(14-10)13(2,3)4;1-2/h6-8H,5H2,1-4H3;1-2H3 |
| InChIKey | PYQOWWUWWIGZLU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |