C8H6ClNS — CID 121231926
5-(chloromethyl)-1,2-benzothiazole (PubChem CID 121231926) has the molecular formula C8H6ClNS and a molecular weight of 183.66 g/mol. Its IUPAC name is 5-(chloromethyl)-1,2-benzothiazole.
| Compound Name | 5-(chloromethyl)-1,2-benzothiazole |
|---|---|
| PubChem CID | 121231926 |
| Molecular Formula | C8H6ClNS |
| Molecular Weight | 183.66 g/mol |
| Exact Mass | 182.99 |
| IUPAC Name | 5-(chloromethyl)-1,2-benzothiazole |
| SMILES | ClCc1ccc2sncc2c1 |
| InChI | InChI=1S/C8H6ClNS/c9-4-6-1-2-8-7(3-6)5-10-11-8/h1-3,5H,4H2 |
| InChIKey | YCGAZUBQELUPQN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.66 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|