C11H14N2S — CID 130678967
N-butyl-1,2-benzothiazol-5-amine (PubChem CID 130678967) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is N-butyl-1,2-benzothiazol-5-amine.
| Compound Name | N-butyl-1,2-benzothiazol-5-amine |
|---|---|
| PubChem CID | 130678967 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | N-butyl-1,2-benzothiazol-5-amine |
| SMILES | CCCCNc1ccc2sncc2c1 |
| InChI | InChI=1S/C11H14N2S/c1-2-3-6-12-10-4-5-11-9(7-10)8-13-14-11/h4-5,7-8,12H,2-3,6H2,1H3 |
| InChIKey | GEKQQVKXXSHRIH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|