C9H10N2S — CID 82599946
2-(1,2-benzothiazol-5-yl)ethanamine (PubChem CID 82599946) has the molecular formula C9H10N2S and a molecular weight of 178.26 g/mol. Its IUPAC name is 2-(1,2-benzothiazol-5-yl)ethanamine.
| Compound Name | 2-(1,2-benzothiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 82599946 |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 2-(1,2-benzothiazol-5-yl)ethanamine |
| SMILES | NCCc1ccc2sncc2c1 |
| InChI | InChI=1S/C9H10N2S/c10-4-3-7-1-2-9-8(5-7)6-11-12-9/h1-2,5-6H,3-4,10H2 |
| InChIKey | ZCJVCLNYGRFEKW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |