C15H12N2O4S2 — CID 166219737
2-[4-(1,2-benzothiazol-5-ylsulfamoyl)phenyl]acetic acid (PubChem CID 166219737) has the molecular formula C15H12N2O4S2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 2-[4-(1,2-benzothiazol-5-ylsulfamoyl)phenyl]acetic acid.
| Compound Name | 2-[4-(1,2-benzothiazol-5-ylsulfamoyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 166219737 |
| Molecular Formula | C15H12N2O4S2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 2-[4-(1,2-benzothiazol-5-ylsulfamoyl)phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(S(=O)(=O)Nc2ccc3sncc3c2)cc1 |
| InChI | InChI=1S/C15H12N2O4S2/c18-15(19)7-10-1-4-13(5-2-10)23(20,21)17-12-3-6-14-11(8-12)9-16-22-14/h1-6,8-9,17H,7H2,(H,18,19) |
| InChIKey | RAKBMYXDVYMMRY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |