C12H11N3O4S — CID 43616102
2-[4-(pyrazin-2-ylsulfamoyl)phenyl]acetic acid (PubChem CID 43616102) has the molecular formula C12H11N3O4S and a molecular weight of 293.30 g/mol. Its IUPAC name is 2-[4-(pyrazin-2-ylsulfamoyl)phenyl]acetic acid.
| Compound Name | 2-[4-(pyrazin-2-ylsulfamoyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 43616102 |
| Molecular Formula | C12H11N3O4S |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 2-[4-(pyrazin-2-ylsulfamoyl)phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(S(=O)(=O)Nc2cnccn2)cc1 |
| InChI | InChI=1S/C12H11N3O4S/c16-12(17)7-9-1-3-10(4-2-9)20(18,19)15-11-8-13-5-6-14-11/h1-6,8H,7H2,(H,14,15)(H,16,17) |
| InChIKey | HPXWUSQSTFXHLE-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |