C10H11N5O4S — CID 43616118
3-[4-(pyrazin-2-ylsulfamoyl)pyrazol-1-yl]propanoic acid (PubChem CID 43616118) has the molecular formula C10H11N5O4S and a molecular weight of 297.30 g/mol. Its IUPAC name is 3-[4-(pyrazin-2-ylsulfamoyl)pyrazol-1-yl]propanoic acid.
| Compound Name | 3-[4-(pyrazin-2-ylsulfamoyl)pyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 43616118 |
| Molecular Formula | C10H11N5O4S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 3-[4-(pyrazin-2-ylsulfamoyl)pyrazol-1-yl]propanoic acid |
| SMILES | O=C(O)CCn1cc(S(=O)(=O)Nc2cnccn2)cn1 |
| InChI | InChI=1S/C10H11N5O4S/c16-10(17)1-4-15-7-8(5-13-15)20(18,19)14-9-6-11-2-3-12-9/h2-3,5-7H,1,4H2,(H,12,14)(H,16,17) |
| InChIKey | OWYKVCVYDNZWSY-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |