C9H15N3O6S2 — CID 60919802
3-[4-(2-methylsulfonylethylsulfamoyl)pyrazol-1-yl]propanoic acid (PubChem CID 60919802) has the molecular formula C9H15N3O6S2 and a molecular weight of 325.37 g/mol. Its IUPAC name is 3-[4-(2-methylsulfonylethylsulfamoyl)pyrazol-1-yl]propanoic acid.
| Compound Name | 3-[4-(2-methylsulfonylethylsulfamoyl)pyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 60919802 |
| Molecular Formula | C9H15N3O6S2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 3-[4-(2-methylsulfonylethylsulfamoyl)pyrazol-1-yl]propanoic acid |
| SMILES | CS(=O)(=O)CCNS(=O)(=O)c1cnn(CCC(=O)O)c1 |
| InChI | InChI=1S/C9H15N3O6S2/c1-19(15,16)5-3-11-20(17,18)8-6-10-12(7-8)4-2-9(13)14/h6-7,11H,2-5H2,1H3,(H,13,14) |
| InChIKey | CEAKGGXUQWLUJK-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |