C9H12N4O4S — CID 55102482
3-[4-(2-cyanoethylsulfamoyl)pyrazol-1-yl]propanoic acid (PubChem CID 55102482) has the molecular formula C9H12N4O4S and a molecular weight of 272.29 g/mol. Its IUPAC name is 3-[4-(2-cyanoethylsulfamoyl)pyrazol-1-yl]propanoic acid.
| Compound Name | 3-[4-(2-cyanoethylsulfamoyl)pyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 55102482 |
| Molecular Formula | C9H12N4O4S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 3-[4-(2-cyanoethylsulfamoyl)pyrazol-1-yl]propanoic acid |
| SMILES | N#CCCNS(=O)(=O)c1cnn(CCC(=O)O)c1 |
| InChI | InChI=1S/C9H12N4O4S/c10-3-1-4-12-18(16,17)8-6-11-13(7-8)5-2-9(14)15/h6-7,12H,1-2,4-5H2,(H,14,15) |
| InChIKey | OWPIOCGBBXCMHB-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 125.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|