About 6-but-2-enoxy-3-methyl-1,2-benzothiazole
6-but-2-enoxy-3-methyl-1,2-benzothiazole (PubChem CID 140979280) has the molecular formula C12H13NOS
and a molecular weight of 219.31 g/mol. Its IUPAC name is 6-but-2-enoxy-3-methyl-1,2-benzothiazole.
Molecular Properties
| Compound Name | 6-but-2-enoxy-3-methyl-1,2-benzothiazole |
| PubChem CID | 140979280 |
| Molecular Formula | C12H13NOS |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 6-but-2-enoxy-3-methyl-1,2-benzothiazole |
| SMILES | CC=CCOc1ccc2c(C)nsc2c1 |
| InChI | InChI=1S/C12H13NOS/c1-3-4-7-14-10-5-6-11-9(2)13-15-12(11)8-10/h3-6,8H,7H2,1-2H3 |
| InChIKey | PNIOBGXXFHABMS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-but-2-enoxy-3-methyl-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-but-2-enoxy-3-methyl-1,2-benzothiazole?
The IUPAC name of 6-but-2-enoxy-3-methyl-1,2-benzothiazole (CID 140979280) is 6-but-2-enoxy-3-methyl-1,2-benzothiazole.
What is the SMILES notation for 6-but-2-enoxy-3-methyl-1,2-benzothiazole?
The canonical SMILES for 6-but-2-enoxy-3-methyl-1,2-benzothiazole is CC=CCOc1ccc2c(C)nsc2c1.
What is the InChIKey of 6-but-2-enoxy-3-methyl-1,2-benzothiazole?
The InChIKey is PNIOBGXXFHABMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NOS/c1-3-4-7-14-10-5-6-11-9(2)13-15-12(11)8-10/h3-6,8H,7H2,1-2H3.
What are the key properties of 6-but-2-enoxy-3-methyl-1,2-benzothiazole?
6-but-2-enoxy-3-methyl-1,2-benzothiazole has a molecular weight of 219.31 g/mol, XLogP of 3.56, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-but-2-enoxy-3-methyl-1,2-benzothiazole is sourced from PubChem (CID 140979280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).