C24H24O2S — CID 54197936
2,5-bis(4-but-2-enoxyphenyl)thiophene (PubChem CID 54197936) has the molecular formula C24H24O2S and a molecular weight of 376.52 g/mol. Its IUPAC name is 2,5-bis(4-but-2-enoxyphenyl)thiophene.
| Compound Name | 2,5-bis(4-but-2-enoxyphenyl)thiophene |
|---|---|
| PubChem CID | 54197936 |
| Molecular Formula | C24H24O2S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2,5-bis(4-but-2-enoxyphenyl)thiophene |
| SMILES | CC=CCOc1ccc(-c2ccc(-c3ccc(OCC=CC)cc3)s2)cc1 |
| InChI | InChI=1S/C24H24O2S/c1-3-5-17-25-21-11-7-19(8-12-21)23-15-16-24(27-23)20-9-13-22(14-10-20)26-18-6-4-2/h3-16H,17-18H2,1-2H3 |
| InChIKey | PNEOQKBMRJKMNY-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|