C20H26OS — CID 23432248
2-[4-[(E)-pent-2-enoxy]phenyl]-5-pentylthiophene (PubChem CID 23432248) has the molecular formula C20H26OS and a molecular weight of 314.49 g/mol. Its IUPAC name is 2-[4-[(E)-pent-2-enoxy]phenyl]-5-pentylthiophene.
| Compound Name | 2-[4-[(E)-pent-2-enoxy]phenyl]-5-pentylthiophene |
|---|---|
| PubChem CID | 23432248 |
| Molecular Formula | C20H26OS |
| Molecular Weight | 314.49 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 2-[4-[(E)-pent-2-enoxy]phenyl]-5-pentylthiophene |
| SMILES | CC/C=C/COc1ccc(-c2ccc(CCCCC)s2)cc1 |
| InChI | InChI=1S/C20H26OS/c1-3-5-7-9-19-14-15-20(22-19)17-10-12-18(13-11-17)21-16-8-6-4-2/h6,8,10-15H,3-5,7,9,16H2,1-2H3/b8-6+ |
| InChIKey | MEPSZZQWYJPSTO-SOFGYWHQSA-N |
| XLogP | 6.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.49 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|