C24H30O2S — CID 101164553
[4-(5-octylthiophen-2-yl)phenyl] (2E,4E)-hexa-2,4-dienoate (PubChem CID 101164553) has the molecular formula C24H30O2S and a molecular weight of 382.57 g/mol. Its IUPAC name is [4-(5-octylthiophen-2-yl)phenyl] (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [4-(5-octylthiophen-2-yl)phenyl] (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 101164553 |
| Molecular Formula | C24H30O2S |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | [4-(5-octylthiophen-2-yl)phenyl] (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)Oc1ccc(-c2ccc(CCCCCCCC)s2)cc1 |
| InChI | InChI=1S/C24H30O2S/c1-3-5-7-8-9-11-12-22-18-19-23(27-22)20-14-16-21(17-15-20)26-24(25)13-10-6-4-2/h4,6,10,13-19H,3,5,7-9,11-12H2,1-2H3/b6-4+,13-10+ |
| InChIKey | IYISHGLCOXFOLT-TVHKTCRSSA-N |
| XLogP | 7.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|