C21H24O2S — CID 172728013
(2E,4E)-2-[4-(5-pentylthiophen-2-yl)phenyl]hexa-2,4-dienoic acid (PubChem CID 172728013) has the molecular formula C21H24O2S and a molecular weight of 340.49 g/mol. Its IUPAC name is (2E,4E)-2-[4-(5-pentylthiophen-2-yl)phenyl]hexa-2,4-dienoic acid.
| Compound Name | (2E,4E)-2-[4-(5-pentylthiophen-2-yl)phenyl]hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 172728013 |
| Molecular Formula | C21H24O2S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (2E,4E)-2-[4-(5-pentylthiophen-2-yl)phenyl]hexa-2,4-dienoic acid |
| SMILES | C/C=C/C=C(/C(=O)O)c1ccc(-c2ccc(CCCCC)s2)cc1 |
| InChI | InChI=1S/C21H24O2S/c1-3-5-7-8-18-14-15-20(24-18)17-12-10-16(11-13-17)19(21(22)23)9-6-4-2/h4,6,9-15H,3,5,7-8H2,1-2H3,(H,22,23)/b6-4+,19-9+ |
| InChIKey | HKFXUJIBFJKYIO-XARLRUKJSA-N |
| XLogP | 6.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|