C25H30O2 — CID 154228550
2-[4-(4-heptylphenyl)phenyl]hexa-2,4-dienoic acid (PubChem CID 154228550) has the molecular formula C25H30O2 and a molecular weight of 362.51 g/mol. Its IUPAC name is 2-[4-(4-heptylphenyl)phenyl]hexa-2,4-dienoic acid.
| Compound Name | 2-[4-(4-heptylphenyl)phenyl]hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 154228550 |
| Molecular Formula | C25H30O2 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 2-[4-(4-heptylphenyl)phenyl]hexa-2,4-dienoic acid |
| SMILES | CC=CC=C(C(=O)O)c1ccc(-c2ccc(CCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C25H30O2/c1-3-5-7-8-9-10-20-12-14-21(15-13-20)22-16-18-23(19-17-22)24(25(26)27)11-6-4-2/h4,6,11-19H,3,5,7-10H2,1-2H3,(H,26,27) |
| InChIKey | WYDOXOXDKBJNGQ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|