C27H31NO2S — CID 54565236
[4-[4-(5-octyl-1,3-thiazol-2-yl)phenyl]phenyl] but-2-enoate (PubChem CID 54565236) has the molecular formula C27H31NO2S and a molecular weight of 433.62 g/mol. Its IUPAC name is [4-[4-(5-octyl-1,3-thiazol-2-yl)phenyl]phenyl] but-2-enoate.
| Compound Name | [4-[4-(5-octyl-1,3-thiazol-2-yl)phenyl]phenyl] but-2-enoate |
|---|---|
| PubChem CID | 54565236 |
| Molecular Formula | C27H31NO2S |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | [4-[4-(5-octyl-1,3-thiazol-2-yl)phenyl]phenyl] but-2-enoate |
| SMILES | CC=CC(=O)Oc1ccc(-c2ccc(-c3ncc(CCCCCCCC)s3)cc2)cc1 |
| InChI | InChI=1S/C27H31NO2S/c1-3-5-6-7-8-9-11-25-20-28-27(31-25)23-14-12-21(13-15-23)22-16-18-24(19-17-22)30-26(29)10-4-2/h4,10,12-20H,3,5-9,11H2,1-2H3 |
| InChIKey | ZTIQEXVLDORTGT-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|