C12H20N2S — CID 143588455
ethane;5-ethyl-2,1,3-benzothiadiazole (PubChem CID 143588455) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is ethane;5-ethyl-2,1,3-benzothiadiazole.
| Compound Name | ethane;5-ethyl-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 143588455 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | ethane;5-ethyl-2,1,3-benzothiadiazole |
| SMILES | CC.CC.CCc1ccc2nsnc2c1 |
| InChI | InChI=1S/C8H8N2S.2C2H6/c1-2-6-3-4-7-8(5-6)10-11-9-7;2*1-2/h3-5H,2H2,1H3;2*1-2H3 |
| InChIKey | AOPSUGDHWARJPG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |