About ethane;5-ethyl-2,1,3-benzothiadiazole
ethane;5-ethyl-2,1,3-benzothiadiazole (PubChem CID 143588455) has the molecular formula C12H20N2S
and a molecular weight of 224.37 g/mol. Its IUPAC name is ethane;5-ethyl-2,1,3-benzothiadiazole.
Molecular Properties
| Compound Name | ethane;5-ethyl-2,1,3-benzothiadiazole |
| PubChem CID | 143588455 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | ethane;5-ethyl-2,1,3-benzothiadiazole |
| SMILES | CC.CC.CCc1ccc2nsnc2c1 |
| InChI | InChI=1S/C8H8N2S.2C2H6/c1-2-6-3-4-7-8(5-6)10-11-9-7;2*1-2/h3-5H,2H2,1H3;2*1-2H3 |
| InChIKey | AOPSUGDHWARJPG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;5-ethyl-2,1,3-benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-ethyl-2,1,3-benzothiadiazole?
The IUPAC name of ethane;5-ethyl-2,1,3-benzothiadiazole (CID 143588455) is ethane;5-ethyl-2,1,3-benzothiadiazole.
What is the SMILES notation for ethane;5-ethyl-2,1,3-benzothiadiazole?
The canonical SMILES for ethane;5-ethyl-2,1,3-benzothiadiazole is CC.CC.CCc1ccc2nsnc2c1.
What is the InChIKey of ethane;5-ethyl-2,1,3-benzothiadiazole?
The InChIKey is AOPSUGDHWARJPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2S.2C2H6/c1-2-6-3-4-7-8(5-6)10-11-9-7;2*1-2/h3-5H,2H2,1H3;2*1-2H3.
What are the key properties of ethane;5-ethyl-2,1,3-benzothiadiazole?
ethane;5-ethyl-2,1,3-benzothiadiazole has a molecular weight of 224.37 g/mol, XLogP of 4.31, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-ethyl-2,1,3-benzothiadiazole is sourced from PubChem (CID 143588455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).